CAS 20725-03-5 appears in our catalog under these names: Fustin, Fustin, 95%, Fustin, 99.6%. Offered by: GLPBio, Combi-blocks, TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 100mg, 1mg, 10mg, 25mg, 1 mg.
(+)-trans-fustin is the (2R,3R)-stereoisomer of fustin.
Source: ChEBI
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | (2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-2,3-dihydrochromen-4-one |
| InChIKey | FNUPUYFWZXZMIE-LSDHHAIUSA-N |
| SMILES | C1=CC(=C(C=C1[C@@H]2[C@H](C(=O)C3=C(O2)C=C(C=C3)O)O)O)O |
Computed by PubChem (NCBI)