Products 78188-48-4
CAS 78188-48-4 appears in our catalog under these names: 6,6'-Methylenebis(benzo[d][1,3]dioxol-5-ol), 98%, 6,6'-Methylenebis-1,3-benzodioxol-5-ol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
6-[(6-hydroxy-1,3-benzodioxol-5-yl)methyl]-1,3-benzodioxol-5-ol (CAS 78188-48-4) is a chemical compound with the molecular formula C15H12O6 and a molecular weight of 288.25 g/mol. IUPAC name: 6-[(6-hydroxy-1,3-benzodioxol-5-yl)methyl]-1,3-benzodioxol-5-ol. InChIKey: PMMQCXVUBOIIPG-UHFFFAOYSA-N.
| Molecular formula | C15H12O6 |
|---|---|
| Molecular weight | 288.25 g/mol |
| IUPAC name | 6-[(6-hydroxy-1,3-benzodioxol-5-yl)methyl]-1,3-benzodioxol-5-ol |
| InChIKey | PMMQCXVUBOIIPG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CC3=CC4=C(C=C3O)OCO4)O |
Computed by PubChem (NCBI)