Products 1220033-45-3
CAS 1220033-45-3 is the registry number for 2-Amino-1-(4-hydroxypiperidin-1-yl)-2-methylpropan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-1-(4-hydroxypiperidin-1-yl)-2-methylpropan-1-one;hydrochloride (CAS 1220033-45-3) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: 2-amino-1-(4-hydroxypiperidin-1-yl)-2-methylpropan-1-one;hydrochloride. InChIKey: VBWFNRUBADAVMA-UHFFFAOYSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | 2-amino-1-(4-hydroxypiperidin-1-yl)-2-methylpropan-1-one;hydrochloride |
| InChIKey | VBWFNRUBADAVMA-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)N1CCC(CC1)O)N.Cl |
Computed by PubChem (NCBI)