CAS 1220039-51-9 appears in our catalog under these names: 1-tert-Butyl 6-methyl 2,3-dihydro-1h-indole-1,6-dicarboxylate, 95%, 1-tert-Butyl 6-methyl 2,3-dihydro-1h-indole-1,6-dicarboxylate, 98%, 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg, 500mg.
1-O-tert-butyl 6-O-methyl 2,3-dihydroindole-1,6-dicarboxylate (CAS 1220039-51-9) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 2,3-dihydroindole-1,6-dicarboxylate. InChIKey: NAMYXEGXVXXICU-UHFFFAOYSA-N.
| Molecular formula | C15H19NO4 |
|---|---|
| Molecular weight | 277.31 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl 2,3-dihydroindole-1,6-dicarboxylate |
| InChIKey | NAMYXEGXVXXICU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)