Products 928771-49-7

CAS 928771-49-7 is the registry number for 1-tert-Butyl 6-methyl indoline-1,6-dicarboxylate, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

1-O-tert-butyl 6-O-methyl 2,3-dihydroindole-1,6-dicarboxylate (CAS 928771-49-7) is a chemical compound with the molecular formula C15H19NO4 and a molecular weight of 277.31 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl 2,3-dihydroindole-1,6-dicarboxylate. InChIKey: NAMYXEGXVXXICU-UHFFFAOYSA-N.

Identity
Molecular formulaC15H19NO4
Molecular weight277.31 g/mol
IUPAC name1-O-tert-butyl 6-O-methyl 2,3-dihydroindole-1,6-dicarboxylate
InChIKeyNAMYXEGXVXXICU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2=C1C=C(C=C2)C(=O)OC

Computed by PubChem (NCBI)