Products 1220630-83-0
CAS 1220630-83-0 is the registry number for 3-Amino-4-(trifluoromethyl)benzonitrile, 98%. Offered by: Combi-blocks, Ambeed, Chemat, BLDpharm, Fluorochem. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
3-amino-4-(trifluoromethyl)benzonitrile (CAS 1220630-83-0) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 3-amino-4-(trifluoromethyl)benzonitrile. InChIKey: CZYRYIJZODSVTK-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 3-amino-4-(trifluoromethyl)benzonitrile |
| InChIKey | CZYRYIJZODSVTK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)N)C(F)(F)F |
Computed by PubChem (NCBI)