CAS 1190309-89-7 appears in our catalog under these names: 4-(Trifluoromethyl)-1h-pyrrolo[3,2-c]pyridine, 95%, 4-(Trifluoromethyl)-5-azaindole, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg, 10g.
4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine (CAS 1190309-89-7) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine. InChIKey: DRULXHMYLHRVMO-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1H-pyrrolo[3,2-c]pyridine |
| InChIKey | DRULXHMYLHRVMO-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=NC=C2)C(F)(F)F |
Computed by PubChem (NCBI)