CAS 944580-91-0 appears in our catalog under these names: 7-Trifluoromethyl-imidazo[1,2-a]pyridine, 98%, 7-(Trifluoromethyl)imidazo(1,2-a)pyridine, 98%, 7-(Trifluoromethyl)imidazo[1,2-a]pyridine, 95%, 95%, 7-TRIFLUOROMETHYL-IMIDAZO[1,2-A]PYRIDINE, 95%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 5g, 100mg.
7-(trifluoromethyl)imidazo[1,2-a]pyridine (CAS 944580-91-0) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 7-(trifluoromethyl)imidazo[1,2-a]pyridine. InChIKey: TUPNGOKBBWGSGZ-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 7-(trifluoromethyl)imidazo[1,2-a]pyridine |
| InChIKey | TUPNGOKBBWGSGZ-UHFFFAOYSA-N |
| SMILES | C1=CN2C=CN=C2C=C1C(F)(F)F |
Computed by PubChem (NCBI)