CAS 1190315-94-6 appears in our catalog under these names: 5-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine, 97%, 5-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine, 95%, 95%, 5-(Trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine (CAS 1190315-94-6) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine. InChIKey: CEHDABSKCYWHHY-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine |
| InChIKey | CEHDABSKCYWHHY-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1NC=C2)C(F)(F)F |
Computed by PubChem (NCBI)