CAS 1092579-96-8 appears in our catalog under these names: 4-(Trifluoromethyl)-1h-pyrrolo[2,3-b]pyridine, 95%, 4–(trifluoroMethyl)–1H–pyrrolo(2,3–b)pyridine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
4-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine (CAS 1092579-96-8) is a chemical compound with the molecular formula C8H5F3N2 and a molecular weight of 186.13 g/mol. IUPAC name: 4-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine. InChIKey: YXLVZAOBNZQKEU-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2 |
|---|---|
| Molecular weight | 186.13 g/mol |
| IUPAC name | 4-(trifluoromethyl)-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | YXLVZAOBNZQKEU-UHFFFAOYSA-N |
| SMILES | C1=CNC2=NC=CC(=C21)C(F)(F)F |
Computed by PubChem (NCBI)