Products 1221341-41-8
CAS 1221341-41-8 is the registry number for 5-Chloro-3-(3-methoxyphenyl)-1,2,4-thiadiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g, 100mg.
5-chloro-3-(3-methoxyphenyl)-1,2,4-thiadiazole (CAS 1221341-41-8) is a chemical compound with the molecular formula C9H7ClN2OS and a molecular weight of 226.68 g/mol. IUPAC name: 5-chloro-3-(3-methoxyphenyl)-1,2,4-thiadiazole. InChIKey: UHVIBQUUKBUFQN-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2OS |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 5-chloro-3-(3-methoxyphenyl)-1,2,4-thiadiazole |
| InChIKey | UHVIBQUUKBUFQN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1)C2=NSC(=N2)Cl |
Computed by PubChem (NCBI)