CAS 871021-06-6 appears in our catalog under these names: 3-Chloro-4-(1,3-thiazol-2-yloxy)aniline, 95%, 3-Chloro-4-(1,3-thiazol-2-yloxy)aniline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3-chloro-4-(1,3-thiazol-2-yloxy)aniline (CAS 871021-06-6) is a chemical compound with the molecular formula C9H7ClN2OS and a molecular weight of 226.68 g/mol. IUPAC name: 3-chloro-4-(1,3-thiazol-2-yloxy)aniline. InChIKey: DCJZLFXZSAWBBQ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2OS |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 3-chloro-4-(1,3-thiazol-2-yloxy)aniline |
| InChIKey | DCJZLFXZSAWBBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)Cl)OC2=NC=CS2 |
Computed by PubChem (NCBI)