CAS 3028-02-2 is the registry number for N-1,3-Benzothiazol-2-yl-2-chloroacetamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
N-(1,3-benzothiazol-2-yl)-2-chloroacetamide (CAS 3028-02-2) is a chemical compound with the molecular formula C9H7ClN2OS and a molecular weight of 226.68 g/mol. IUPAC name: N-(1,3-benzothiazol-2-yl)-2-chloroacetamide. InChIKey: CMUZFXFDVGLPGO-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2OS |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | N-(1,3-benzothiazol-2-yl)-2-chloroacetamide |
| InChIKey | CMUZFXFDVGLPGO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)NC(=O)CCl |
Computed by PubChem (NCBI)