CAS 55327-43-0 is the registry number for 3-(4-Chlorophenyl)-2-thioxoimidazolidin-4-one, 97%. Offered by: AmBeed. Available pack sizes: 10g.
3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-4-one (CAS 55327-43-0) is a chemical compound with the molecular formula C9H7ClN2OS and a molecular weight of 226.68 g/mol. IUPAC name: 3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-4-one. InChIKey: GIKZSOCWOZJBCD-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2OS |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-2-sulfanylideneimidazolidin-4-one |
| InChIKey | GIKZSOCWOZJBCD-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C(=S)N1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)