CAS 39130-93-3 appears in our catalog under these names: 2–((2–chlorophenyl)amino)–1,3–thiazol–4(5h)–one, 2-[(2-chlorophenyl)imino]-1,3-thiazolidin-4-one, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 1g, 250mg.
2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one (CAS 39130-93-3) is a chemical compound with the molecular formula C9H7ClN2OS and a molecular weight of 226.68 g/mol. IUPAC name: 2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one. InChIKey: WSJNVJNVVOOKGP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2OS |
|---|---|
| Molecular weight | 226.68 g/mol |
| IUPAC name | 2-(2-chlorophenyl)imino-1,3-thiazolidin-4-one |
| InChIKey | WSJNVJNVVOOKGP-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC(=NC2=CC=CC=C2Cl)S1 |
Computed by PubChem (NCBI)