CAS 1221342-38-6 appears in our catalog under these names: 5-Chloro-3-(m-tolyl)-1,2,4-thiadiazole, 97%, 5-Chloro-3-(3-methylphenyl)-1,2,4-thiadiazole. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 100mg, 1g.
5-chloro-3-(3-methylphenyl)-1,2,4-thiadiazole (CAS 1221342-38-6) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 5-chloro-3-(3-methylphenyl)-1,2,4-thiadiazole. InChIKey: NQMANBSOUSXOOI-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 5-chloro-3-(3-methylphenyl)-1,2,4-thiadiazole |
| InChIKey | NQMANBSOUSXOOI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=NSC(=N2)Cl |
Computed by PubChem (NCBI)