CAS 221038-01-3 is the registry number for 5-Chloro-3-p-tolyl-[1,2,4]thiadiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-3-(4-methylphenyl)-1,2,4-thiadiazole (CAS 221038-01-3) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 5-chloro-3-(4-methylphenyl)-1,2,4-thiadiazole. InChIKey: HSGWDQKQCPUKAE-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 5-chloro-3-(4-methylphenyl)-1,2,4-thiadiazole |
| InChIKey | HSGWDQKQCPUKAE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NSC(=N2)Cl |
Computed by PubChem (NCBI)