CAS 1249447-08-2 appears in our catalog under these names: 5-(3-Chlorophenyl)thiazol-2-amine, 95+%, 5-(3-Chlorophenyl)-1,3-thiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
5-(3-chlorophenyl)-1,3-thiazol-2-amine (CAS 1249447-08-2) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 5-(3-chlorophenyl)-1,3-thiazol-2-amine. InChIKey: QPKXBEAXNVKWQP-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 5-(3-chlorophenyl)-1,3-thiazol-2-amine |
| InChIKey | QPKXBEAXNVKWQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=CN=C(S2)N |
Computed by PubChem (NCBI)