CAS 99067-57-9 appears in our catalog under these names: 3-Benzyl-5-chloro-1,2,4-thiadiazole, 95%, 3-Benzyl-5-chloro-1,2,4-thiadiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg, 2,5g.
3-benzyl-5-chloro-1,2,4-thiadiazole (CAS 99067-57-9) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 3-benzyl-5-chloro-1,2,4-thiadiazole. InChIKey: PUGFKQSEHPLELH-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 3-benzyl-5-chloro-1,2,4-thiadiazole |
| InChIKey | PUGFKQSEHPLELH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NSC(=N2)Cl |
Computed by PubChem (NCBI)