CAS 17452-12-9 appears in our catalog under these names: 1-(4-Chlorophenyl)-1h-imidazole-2-thiol, 95%, 1-(4-Chlorophenyl)imidazoline-2-thione, 98%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 1g, 5g, 2.5g.
3-(4-chlorophenyl)-1H-imidazole-2-thione (CAS 17452-12-9) is a chemical compound with the molecular formula C9H7ClN2S and a molecular weight of 210.68 g/mol. IUPAC name: 3-(4-chlorophenyl)-1H-imidazole-2-thione. InChIKey: QJWMVYCYPCPSKK-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2S |
|---|---|
| Molecular weight | 210.68 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1H-imidazole-2-thione |
| InChIKey | QJWMVYCYPCPSKK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=CNC2=S)Cl |
Computed by PubChem (NCBI)