Products 1221504-65-9
CAS 1221504-65-9 is the registry number for 4-Hydroxy-2-oxo-1-phenyl-N-(p-tolyl)-2,5-dihydro-1H-pyrrole-3-carboxamide, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 250mg, 1g, 100mg.
3-hydroxy-N-(4-methylphenyl)-5-oxo-1-phenyl-2H-pyrrole-4-carboxamide (CAS 1221504-65-9) is a chemical compound with the molecular formula C18H16N2O3 and a molecular weight of 308.3 g/mol. IUPAC name: 3-hydroxy-N-(4-methylphenyl)-5-oxo-1-phenyl-2H-pyrrole-4-carboxamide. InChIKey: DGMKRIKZWVAOLV-UHFFFAOYSA-N.
| Molecular formula | C18H16N2O3 |
|---|---|
| Molecular weight | 308.3 g/mol |
| IUPAC name | 3-hydroxy-N-(4-methylphenyl)-5-oxo-1-phenyl-2H-pyrrole-4-carboxamide |
| InChIKey | DGMKRIKZWVAOLV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C2=C(CN(C2=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)