Products 1221723-09-6
CAS 1221723-09-6 appears in our catalog under these names: 4-(Methyl(2-methylpropyl)amino)benzoic acid hydrochloride, 95%, 4-(Methyl(2-methylpropyl)amino)benzoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
4-[methyl(2-methylpropyl)amino]benzoic acid;hydrochloride (CAS 1221723-09-6) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 4-[methyl(2-methylpropyl)amino]benzoic acid;hydrochloride. InChIKey: PYCPWONGHVICDQ-UHFFFAOYSA-N.
| Molecular formula | C12H18ClNO2 |
|---|---|
| Molecular weight | 243.73 g/mol |
| IUPAC name | 4-[methyl(2-methylpropyl)amino]benzoic acid;hydrochloride |
| InChIKey | PYCPWONGHVICDQ-UHFFFAOYSA-N |
| SMILES | CC(C)CN(C)C1=CC=C(C=C1)C(=O)O.Cl |
Computed by PubChem (NCBI)