Products 1221724-08-8

CAS 1221724-08-8 appears in our catalog under these names: 4-[Ethyl(propyl)amino]benzoic acid hydrochloride, 95%, 4-(Ethyl(propyl)amino)benzoic acid hydrochloride, 95%, 4-(Ethyl(propyl)amino)benzoic acid hydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.

Structural formula: {0} (CAS {1})

4-[ethyl(propyl)amino]benzoic acid;hydrochloride (CAS 1221724-08-8) is a chemical compound with the molecular formula C12H18ClNO2 and a molecular weight of 243.73 g/mol. IUPAC name: 4-[ethyl(propyl)amino]benzoic acid;hydrochloride. InChIKey: KVYQVRAFLVXHOB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18ClNO2
Molecular weight243.73 g/mol
IUPAC name4-[ethyl(propyl)amino]benzoic acid;hydrochloride
InChIKeyKVYQVRAFLVXHOB-UHFFFAOYSA-N
SMILESCCCN(CC)C1=CC=C(C=C1)C(=O)O.Cl

Computed by PubChem (NCBI)