Products 812642-70-9

CAS 812642-70-9 is the registry number for 2-[4-(3-Formyl-2,5-dimethyl-1h-pyrrol-1-yl)phenoxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]propanoic acid (CAS 812642-70-9) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: 2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]propanoic acid. InChIKey: NNWLCURZXVIPEC-UHFFFAOYSA-N.

Identity
Molecular formulaC16H17NO4
Molecular weight287.31 g/mol
IUPAC name2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]propanoic acid
InChIKeyNNWLCURZXVIPEC-UHFFFAOYSA-N
SMILESCC1=CC(=C(N1C2=CC=C(C=C2)OC(C)C(=O)O)C)C=O

Computed by PubChem (NCBI)