CAS 812642-70-9 is the registry number for 2-[4-(3-Formyl-2,5-dimethyl-1h-pyrrol-1-yl)phenoxy]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]propanoic acid (CAS 812642-70-9) is a chemical compound with the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. IUPAC name: 2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]propanoic acid. InChIKey: NNWLCURZXVIPEC-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4 |
|---|---|
| Molecular weight | 287.31 g/mol |
| IUPAC name | 2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]propanoic acid |
| InChIKey | NNWLCURZXVIPEC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)OC(C)C(=O)O)C)C=O |
Computed by PubChem (NCBI)