CAS 122225-42-7 is the registry number for Rel-benzyl (3S,4R)-3,4-dihydroxypyrrolidine-1-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 100mg.
Benzyl (3R,4S)-3,4-dihydroxypyrrolidine-1-carboxylate (CAS 122225-42-7) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: benzyl (3R,4S)-3,4-dihydroxypyrrolidine-1-carboxylate. InChIKey: OSDPRBVIIIGHPO-PHIMTYICSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | benzyl (3R,4S)-3,4-dihydroxypyrrolidine-1-carboxylate |
| InChIKey | OSDPRBVIIIGHPO-PHIMTYICSA-N |
| SMILES | C1[C@H]([C@H](CN1C(=O)OCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)