CAS 637337-65-6 appears in our catalog under these names: (S)-3-(((Benzyloxy)carbonyl)amino)-2-methylpropanoic acid, 95%, (S)–3–(((Benzyloxy)carbonyl)amino)–2–methylpropanoic acid, Cbz-S-3-Aminoisobutyric acid 98%, (S)-3-(((Benzyloxy)carbonyl)amino)-2-methylpropanoic acid, 98%, 98%, (S)-3-(((Benzyloxy)carbonyl)amino)-2-methylpropanoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 5g, 250mg, 10g.
(2S)-2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid (CAS 637337-65-6) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: YDSJUQJHDFBDSZ-VIFPVBQESA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-methyl-3-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | YDSJUQJHDFBDSZ-VIFPVBQESA-N |
| SMILES | C[C@@H](CNC(=O)OCC1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)