CAS 121148-97-8 appears in our catalog under these names: 3-([(Benzyloxy)carbonyl](methyl)amino)propanoic acid, 95%, 3-(((Benzyloxy)carbonyl)(methyl)amino)propanoic acid, 3-([(Benzyloxy)carbonyl](methyl)amino)propanoic acid, 95+%, 95+%, 3-(((Benzyloxy)carbonyl)(methyl)amino)propanoic acid, 97%, 3-(((Benzyloxy)carbonyl)(methyl)amino)propanoic acid, 95+%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 0,5g, 5g, 100mg.
3-[methyl(phenylmethoxycarbonyl)amino]propanoic acid (CAS 121148-97-8) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: 3-[methyl(phenylmethoxycarbonyl)amino]propanoic acid. InChIKey: JOAXIARPFFSPAS-UHFFFAOYSA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | 3-[methyl(phenylmethoxycarbonyl)amino]propanoic acid |
| InChIKey | JOAXIARPFFSPAS-UHFFFAOYSA-N |
| SMILES | CN(CCC(=O)O)C(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)