Products 68223-02-9

CAS 68223-02-9 is the registry number for N-Alpha-carbobenzoxy-d-alanine methyl ester, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(phenylmethoxycarbonylamino)propanoate (CAS 68223-02-9) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: methyl 2-(phenylmethoxycarbonylamino)propanoate. InChIKey: OMDVFTVXPVXANK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO4
Molecular weight237.25 g/mol
IUPAC namemethyl 2-(phenylmethoxycarbonylamino)propanoate
InChIKeyOMDVFTVXPVXANK-UHFFFAOYSA-N
SMILESCC(C(=O)OC)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)