CAS 77539-18-5 is the registry number for (S)-N-Benzylglutamic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
(2S)-2-(benzylamino)pentanedioic acid (CAS 77539-18-5) is a chemical compound with the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. IUPAC name: (2S)-2-(benzylamino)pentanedioic acid. InChIKey: IHSNQUNHINYDDN-JTQLQIEISA-N.
| Molecular formula | C12H15NO4 |
|---|---|
| Molecular weight | 237.25 g/mol |
| IUPAC name | (2S)-2-(benzylamino)pentanedioic acid |
| InChIKey | IHSNQUNHINYDDN-JTQLQIEISA-N |
| SMILES | C1=CC=C(C=C1)CN[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)