CAS 1223431-91-1 is the registry number for TERT-BUTYL 4-(3,5-DICHLOROPYRIDIN-2-YL)PIPERAZINE-1-CARBOXYLATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl 4-(3,5-dichloro-2-pyridinyl)piperazine-1-carboxylate (CAS 1223431-91-1) is a chemical compound with the molecular formula C14H19Cl2N3O2 and a molecular weight of 332.2 g/mol. IUPAC name: tert-butyl 4-(3,5-dichloro-2-pyridinyl)piperazine-1-carboxylate. InChIKey: CQYFEMHRRBCDBP-UHFFFAOYSA-N.
| Molecular formula | C14H19Cl2N3O2 |
|---|---|
| Molecular weight | 332.2 g/mol |
| IUPAC name | tert-butyl 4-(3,5-dichloro-2-pyridinyl)piperazine-1-carboxylate |
| InChIKey | CQYFEMHRRBCDBP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CC1)C2=C(C=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)