CAS 1223525-41-4 is the registry number for N-(3-Cyanobenzyl)-4-methylthiazole-5-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3-cyanophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide (CAS 1223525-41-4) is a chemical compound with the molecular formula C13H11N3OS and a molecular weight of 257.31 g/mol. IUPAC name: N-[(3-cyanophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide. InChIKey: HYAJVFRKWLQQDK-UHFFFAOYSA-N.
| Molecular formula | C13H11N3OS |
|---|---|
| Molecular weight | 257.31 g/mol |
| IUPAC name | N-[(3-cyanophenyl)methyl]-4-methyl-1,3-thiazole-5-carboxamide |
| InChIKey | HYAJVFRKWLQQDK-UHFFFAOYSA-N |
| SMILES | CC1=C(SC=N1)C(=O)NCC2=CC(=CC=C2)C#N |
Computed by PubChem (NCBI)