CAS 1223748-25-1 is the registry number for 3,5-Di-tert-butylphenyl acrylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(3,5-ditert-butylphenyl) prop-2-enoate (CAS 1223748-25-1) is a chemical compound with the molecular formula C17H24O2 and a molecular weight of 260.4 g/mol. IUPAC name: (3,5-ditert-butylphenyl) prop-2-enoate. InChIKey: GMWRUVMAYZGSHK-UHFFFAOYSA-N.
| Molecular formula | C17H24O2 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | (3,5-ditert-butylphenyl) prop-2-enoate |
| InChIKey | GMWRUVMAYZGSHK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)OC(=O)C=C)C(C)(C)C |
Computed by PubChem (NCBI)