Products 58641-29-5
CAS 58641-29-5 appears in our catalog under these names: Emtricitabine Impurity 30, (1S,2R,5S)-2-Isopropyl-5-methylcyclohexyl benzoate, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 1g, 5g, 10g, 25g, 50g.
[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] benzoate (CAS 58641-29-5) is a chemical compound with the molecular formula C17H24O2 and a molecular weight of 260.4 g/mol. IUPAC name: [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] benzoate. InChIKey: TTYVYRHNIVBWCB-IMJJTQAJSA-N.
| Molecular formula | C17H24O2 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] benzoate |
| InChIKey | TTYVYRHNIVBWCB-IMJJTQAJSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@H](C1)OC(=O)C2=CC=CC=C2)C(C)C |
Computed by PubChem (NCBI)