Products 87038-98-0
CAS 87038-98-0 is the registry number for Emtricitabine Impurity 39. Offered by: Chemat Brand. Available pack sizes: on request.
[(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] benzoate (CAS 87038-98-0) is a chemical compound with the molecular formula C17H24O2 and a molecular weight of 260.4 g/mol. IUPAC name: [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] benzoate. InChIKey: TTYVYRHNIVBWCB-NUEKZKHPSA-N.
| Molecular formula | C17H24O2 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | [(1R,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] benzoate |
| InChIKey | TTYVYRHNIVBWCB-NUEKZKHPSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@@H](C1)OC(=O)C2=CC=CC=C2)C(C)C |
Computed by PubChem (NCBI)