CAS 31481-49-9 is the registry number for Emtricitabine Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.
[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzoate (CAS 31481-49-9) is a chemical compound with the molecular formula C17H24O2 and a molecular weight of 260.4 g/mol. IUPAC name: [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzoate. InChIKey: TTYVYRHNIVBWCB-KBMXLJTQSA-N.
| Molecular formula | C17H24O2 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzoate |
| InChIKey | TTYVYRHNIVBWCB-KBMXLJTQSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@H](C1)OC(=O)C2=CC=CC=C2)C(C)C |
Computed by PubChem (NCBI)