Products 31481-49-9

CAS 31481-49-9 is the registry number for Emtricitabine Impurity 33. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzoate (CAS 31481-49-9) is a chemical compound with the molecular formula C17H24O2 and a molecular weight of 260.4 g/mol. IUPAC name: [(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzoate. InChIKey: TTYVYRHNIVBWCB-KBMXLJTQSA-N.

Identity
Molecular formulaC17H24O2
Molecular weight260.4 g/mol
IUPAC name[(1S,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] benzoate
InChIKeyTTYVYRHNIVBWCB-KBMXLJTQSA-N
SMILESC[C@@H]1CC[C@H]([C@H](C1)OC(=O)C2=CC=CC=C2)C(C)C

Computed by PubChem (NCBI)