CAS 2309453-09-4 is the registry number for 2-(4-Cyclopropyl-2,6-diisopropylphenyl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[4-cyclopropyl-2,6-di(propan-2-yl)phenyl]acetic acid (CAS 2309453-09-4) is a chemical compound with the molecular formula C17H24O2 and a molecular weight of 260.4 g/mol. IUPAC name: 2-[4-cyclopropyl-2,6-di(propan-2-yl)phenyl]acetic acid. InChIKey: YSBVJCIRESKXRX-UHFFFAOYSA-N.
| Molecular formula | C17H24O2 |
|---|---|
| Molecular weight | 260.4 g/mol |
| IUPAC name | 2-[4-cyclopropyl-2,6-di(propan-2-yl)phenyl]acetic acid |
| InChIKey | YSBVJCIRESKXRX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1CC(=O)O)C(C)C)C2CC2 |
Computed by PubChem (NCBI)