Products 122455-86-1
CAS 122455-86-1 is the registry number for 4-Fluoro-2-methylphenyl methyl carbonate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-fluoro-2-methylphenyl) methyl carbonate (CAS 122455-86-1) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: (4-fluoro-2-methylphenyl) methyl carbonate. InChIKey: KIQNTUVEIYAMDA-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | (4-fluoro-2-methylphenyl) methyl carbonate |
| InChIKey | KIQNTUVEIYAMDA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)F)OC(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
4-Fluoro-2-methylphenyl Methoxyformate, 4-fluoro-2-methylphenyl methyl carbonate, Carbonic acid, 4-fluoro-2-methylphenyl methyl ester, (4-fluoro-2-methylphenyl) methyl carbonate, (4-fluoro-2-methyl-phenyl) Methyl Carbonate, KIQNTUVEIYAMDA-UHFFFAOYSA-N, Methyl 4-fluoro-2-methylphenyl carbonate, carbonic acid 4-fluoro-2-methyl-phenyl ester methyl ester