Products 1224743-11-6
CAS 1224743-11-6 is the registry number for tert-Butyl 3-methylpyrrolo[2,3-b]pyridine-1-carboxylate, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 3-methylpyrrolo[2,3-b]pyridine-1-carboxylate (CAS 1224743-11-6) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: tert-butyl 3-methylpyrrolo[2,3-b]pyridine-1-carboxylate. InChIKey: FTTPFIUDNUQAOE-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | tert-butyl 3-methylpyrrolo[2,3-b]pyridine-1-carboxylate |
| InChIKey | FTTPFIUDNUQAOE-UHFFFAOYSA-N |
| SMILES | CC1=CN(C2=C1C=CC=N2)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)