CAS 1225618-63-2 is the registry number for 1-(3,4-Dichlorophenyl)-2-(ethylamino)-1-propanonediscontinued. please see c178985. Offered by: Biosynth. Available pack sizes: 25mg, 50mg, 100mg.
1-(3,4-dichlorophenyl)-2-(ethylamino)propan-1-one (CAS 1225618-63-2) is a chemical compound with the molecular formula C11H13Cl2NO and a molecular weight of 246.13 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2-(ethylamino)propan-1-one. InChIKey: BIYFBWRLDKOYMU-UHFFFAOYSA-N.
| Molecular formula | C11H13Cl2NO |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2-(ethylamino)propan-1-one |
| InChIKey | BIYFBWRLDKOYMU-UHFFFAOYSA-N |
| SMILES | CCNC(C)C(=O)C1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)