Products 122587-87-5
CAS 122587-87-5 is the registry number for (3R)-3′,8-Dihydroxyvestitol. Offered by: MedChemExpress. Available pack sizes: Get quote.
3-(2,3-dihydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromene-7,8-diol (CAS 122587-87-5) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: 3-(2,3-dihydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromene-7,8-diol. InChIKey: BPAJYCPZCVWTTL-UHFFFAOYSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | 3-(2,3-dihydroxy-4-methoxyphenyl)-3,4-dihydro-2H-chromene-7,8-diol |
| InChIKey | BPAJYCPZCVWTTL-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C2CC3=C(C(=C(C=C3)O)O)OC2)O)O |
Computed by PubChem (NCBI)