Products 1225957-81-2
CAS 1225957-81-2 is the registry number for 5-Chloro-2-oxoindoline-7-carboxylic acid, 97%. Offered by: Ambeed, BLDpharm, Chemat. Available pack sizes: 100mg, 250mg, 1g.
5-chloro-2-oxo-1,3-dihydroindole-7-carboxylic acid (CAS 1225957-81-2) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 5-chloro-2-oxo-1,3-dihydroindole-7-carboxylic acid. InChIKey: SBRVXUPWFIQKOF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 5-chloro-2-oxo-1,3-dihydroindole-7-carboxylic acid |
| InChIKey | SBRVXUPWFIQKOF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)Cl)C(=O)O)NC1=O |
Computed by PubChem (NCBI)