CAS 1226-42-2 appears in our catalog under these names: 4,4'-DIMETHOXYBENZIL/ 98%, Anisil, 98+% , 4,4'-Dimethoxydibenzoyl, p-Anisil, >98.0%(GC), 4,4'-Dimethoxybenzil, 99+%. Offered by: TargetMol, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 1g, 5g, 25g, 100g, 0,1kg, 0,05kg, 0,25kg, 1000g.
1,2-bis(4-methoxyphenyl)ethane-1,2-dione (CAS 1226-42-2) is a chemical compound with the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. IUPAC name: 1,2-bis(4-methoxyphenyl)ethane-1,2-dione. InChIKey: YNANGXWUZWWFKX-UHFFFAOYSA-N.
| Molecular formula | C16H14O4 |
|---|---|
| Molecular weight | 270.28 g/mol |
| IUPAC name | 1,2-bis(4-methoxyphenyl)ethane-1,2-dione |
| InChIKey | YNANGXWUZWWFKX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)