Products 1226036-70-9
CAS 1226036-70-9 appears in our catalog under these names: 2-Chloro-N-(2,3-dihydro-benzo(1,4)dioxin-6-ylmethyl)-acetamide, 2-Chloro-N-(2,3-dihydro-benzo[1,4]dioxin-6-ylmethyl)-acetamide. Offered by: Biosynth, Fluorochem. Available pack sizes: 0,5g, 1g, 2g, 500mg.
2-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)acetamide (CAS 1226036-70-9) is a chemical compound with the molecular formula C11H12ClNO3 and a molecular weight of 241.67 g/mol. IUPAC name: 2-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)acetamide. InChIKey: SETNKMWGSPVULQ-UHFFFAOYSA-N.
| Molecular formula | C11H12ClNO3 |
|---|---|
| Molecular weight | 241.67 g/mol |
| IUPAC name | 2-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)acetamide |
| InChIKey | SETNKMWGSPVULQ-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)CNC(=O)CCl |
Computed by PubChem (NCBI)