CAS 1226263-99-5 is the registry number for 4-Methoxy-2-methylbenzenesulfonyl isocyanate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-methoxy-2-methyl-N-(oxomethylidene)benzenesulfonamide (CAS 1226263-99-5) is a chemical compound with the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. IUPAC name: 4-methoxy-2-methyl-N-(oxomethylidene)benzenesulfonamide. InChIKey: OOIJAJGBPJAZFI-UHFFFAOYSA-N.
| Molecular formula | C9H9NO4S |
|---|---|
| Molecular weight | 227.24 g/mol |
| IUPAC name | 4-methoxy-2-methyl-N-(oxomethylidene)benzenesulfonamide |
| InChIKey | OOIJAJGBPJAZFI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)OC)S(=O)(=O)N=C=O |
Computed by PubChem (NCBI)