Products 1226271-16-4
CAS 1226271-16-4 is the registry number for 4-(Methyl(prop-2-en-1-yl)sulfamoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4-[methyl(prop-2-enyl)sulfamoyl]benzoic acid (CAS 1226271-16-4) is a chemical compound with the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. IUPAC name: 4-[methyl(prop-2-enyl)sulfamoyl]benzoic acid. InChIKey: NTIZOERQCSXKJX-UHFFFAOYSA-N.
| Molecular formula | C11H13NO4S |
|---|---|
| Molecular weight | 255.29 g/mol |
| IUPAC name | 4-[methyl(prop-2-enyl)sulfamoyl]benzoic acid |
| InChIKey | NTIZOERQCSXKJX-UHFFFAOYSA-N |
| SMILES | CN(CC=C)S(=O)(=O)C1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)