CAS 1226857-72-2 is the registry number for 2-([1,1'-Biphenyl]-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,2-difluoro-2-(2-phenylphenyl)acetic acid (CAS 1226857-72-2) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2,2-difluoro-2-(2-phenylphenyl)acetic acid. InChIKey: NYGBSRIHGKEKFQ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O2 |
|---|---|
| Molecular weight | 248.22 g/mol |
| IUPAC name | 2,2-difluoro-2-(2-phenylphenyl)acetic acid |
| InChIKey | NYGBSRIHGKEKFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC=C2C(C(=O)O)(F)F |
Computed by PubChem (NCBI)