Products 1226857-72-2

CAS 1226857-72-2 is the registry number for 2-([1,1'-Biphenyl]-2-yl)-2,2-difluoroacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2,2-difluoro-2-(2-phenylphenyl)acetic acid (CAS 1226857-72-2) is a chemical compound with the molecular formula C14H10F2O2 and a molecular weight of 248.22 g/mol. IUPAC name: 2,2-difluoro-2-(2-phenylphenyl)acetic acid. InChIKey: NYGBSRIHGKEKFQ-UHFFFAOYSA-N.

Identity
Molecular formulaC14H10F2O2
Molecular weight248.22 g/mol
IUPAC name2,2-difluoro-2-(2-phenylphenyl)acetic acid
InChIKeyNYGBSRIHGKEKFQ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=CC=CC=C2C(C(=O)O)(F)F

Computed by PubChem (NCBI)