Products 1226919-57-8
CAS 1226919-57-8 appears in our catalog under these names: L-4-Hydroxyphenyl-d4-alanine-2-d1, 98 atom % D, min 98% Chemical Purity, L–Tyrosine–d5, L-Tyrosine-d5, 99.90%. Offered by: CDN, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 5mg, 10 mg.
(2S)-2-amino-2-deuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid (CAS 1226919-57-8) is a chemical compound with the molecular formula C9H11NO3 and a molecular weight of 186.22 g/mol. IUPAC name: (2S)-2-amino-2-deuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid. InChIKey: OUYCCCASQSFEME-DINGIVGRSA-N.
| Molecular formula | C9H11NO3 |
|---|---|
| Molecular weight | 186.22 g/mol |
| IUPAC name | (2S)-2-amino-2-deuterio-3-(2,3,5,6-tetradeuterio-4-hydroxyphenyl)propanoic acid |
| InChIKey | OUYCCCASQSFEME-DINGIVGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1C[C@@]([2H])(C(=O)O)N)[2H])[2H])O)[2H] |
Computed by PubChem (NCBI)