CAS 1227617-38-0 appears in our catalog under these names: tert-Butyl 3-(3,4-difluorophenyl)-3-hydroxyazetidine-1-carboxylate, 98%, tert-Butyl 3-(3,4-difluorophenyl)-3-hydroxyazetidine-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Tert-butyl 3-(3,4-difluorophenyl)-3-hydroxyazetidine-1-carboxylate (CAS 1227617-38-0) is a chemical compound with the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. IUPAC name: tert-butyl 3-(3,4-difluorophenyl)-3-hydroxyazetidine-1-carboxylate. InChIKey: IGEGOOFDIBQXOY-UHFFFAOYSA-N.
| Molecular formula | C14H17F2NO3 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | tert-butyl 3-(3,4-difluorophenyl)-3-hydroxyazetidine-1-carboxylate |
| InChIKey | IGEGOOFDIBQXOY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C2=CC(=C(C=C2)F)F)O |
Computed by PubChem (NCBI)