Products 1303973-82-1

CAS 1303973-82-1 is the registry number for benzyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate, 96%, 96%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Benzyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate (CAS 1303973-82-1) is a chemical compound with the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. IUPAC name: benzyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate. InChIKey: HXHBYPJELHLMKW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17F2NO3
Molecular weight285.29 g/mol
IUPAC namebenzyl 3,3-difluoro-4-(hydroxymethyl)piperidine-1-carboxylate
InChIKeyHXHBYPJELHLMKW-UHFFFAOYSA-N
SMILESC1CN(CC(C1CO)(F)F)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)