CAS 1858250-79-9 appears in our catalog under these names: Methyl 4-(2,6-dimethylmorpholin-4-yl)-2,5-difluorobenzoate, 95%, Methyl 4-(2,6-dimethylmorpholin-4-yl)-2,5-difluorobenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
Methyl 4-(2,6-dimethylmorpholin-4-yl)-2,5-difluorobenzoate (CAS 1858250-79-9) is a chemical compound with the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. IUPAC name: methyl 4-(2,6-dimethylmorpholin-4-yl)-2,5-difluorobenzoate. InChIKey: JKQRKWLCLDRHGX-UHFFFAOYSA-N.
| Molecular formula | C14H17F2NO3 |
|---|---|
| Molecular weight | 285.29 g/mol |
| IUPAC name | methyl 4-(2,6-dimethylmorpholin-4-yl)-2,5-difluorobenzoate |
| InChIKey | JKQRKWLCLDRHGX-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C2=C(C=C(C(=C2)F)C(=O)OC)F |
Computed by PubChem (NCBI)